C41H39N3O4 — CID 137071439
pentyl 2-[3-hydroxy-4-[4-(4-phenylcyclohexa-1,5-dien-1-yl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenoxy]propanoate (PubChem CID 137071439) has the molecular formula C41H39N3O4 and a molecular weight of 637.78 g/mol. Its IUPAC name is pentyl 2-[3-hydroxy-4-[4-(4-phenylcyclohexa-1,5-dien-1-yl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenoxy]propanoate.
| Compound Name | pentyl 2-[3-hydroxy-4-[4-(4-phenylcyclohexa-1,5-dien-1-yl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenoxy]propanoate |
|---|---|
| PubChem CID | 137071439 |
| Molecular Formula | C41H39N3O4 |
| Molecular Weight | 637.78 g/mol |
| Exact Mass | 637.29 |
| IUPAC Name | pentyl 2-[3-hydroxy-4-[4-(4-phenylcyclohexa-1,5-dien-1-yl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenoxy]propanoate |
| SMILES | CCCCCOC(=O)C(C)Oc1ccc(-c2nc(C3=CCC(c4ccccc4)C=C3)nc(-c3ccc(-c4ccccc4)cc3)n2)c(O)c1 |
| InChI | InChI=1S/C41H39N3O4/c1-3-4-11-26-47-41(46)28(2)48-35-24-25-36(37(45)27-35)40-43-38(33-20-16-31(17-21-33)29-12-7-5-8-13-29)42-39(44-40)34-22-18-32(19-23-34)30-14-9-6-10-15-30/h5-10,12-18,20-25,27-28,32,45H,3-4,11,19,26H2,1-2H3 |
| InChIKey | TVQUHDQACLDELT-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 94.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.78 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|