C33H35N3O9 — CID 136627982
ethyl 2-[4-[4-(4-ethyl-2-hydroxyphenyl)-6-[4-[(Z)-1-ethylperoxyprop-1-enoxy]-2-hydroxyphenyl]-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]propanoate (PubChem CID 136627982) has the molecular formula C33H35N3O9 and a molecular weight of 617.65 g/mol. Its IUPAC name is ethyl 2-[4-[4-(4-ethyl-2-hydroxyphenyl)-6-[4-[(Z)-1-ethylperoxyprop-1-enoxy]-2-hydroxyphenyl]-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]propanoate.
| Compound Name | ethyl 2-[4-[4-(4-ethyl-2-hydroxyphenyl)-6-[4-[(Z)-1-ethylperoxyprop-1-enoxy]-2-hydroxyphenyl]-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]propanoate |
|---|---|
| PubChem CID | 136627982 |
| Molecular Formula | C33H35N3O9 |
| Molecular Weight | 617.65 g/mol |
| Exact Mass | 617.24 |
| IUPAC Name | ethyl 2-[4-[4-(4-ethyl-2-hydroxyphenyl)-6-[4-[(Z)-1-ethylperoxyprop-1-enoxy]-2-hydroxyphenyl]-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]propanoate |
| SMILES | C/C=C(\OOCC)Oc1ccc(-c2nc(-c3ccc(CC)cc3O)nc(-c3ccc(OC(C)C(=O)OCC)cc3O)n2)c(O)c1 |
| InChI | InChI=1S/C33H35N3O9/c1-6-20-10-13-23(26(37)16-20)30-34-31(24-14-11-21(17-27(24)38)43-19(5)33(40)41-8-3)36-32(35-30)25-15-12-22(18-28(25)39)44-29(7-2)45-42-9-4/h7,10-19,37-39H,6,8-9H2,1-5H3/b29-7- |
| InChIKey | SOOIEKQRTFQBEZ-BPQMRJFZSA-N |
| XLogP | 6.09 |
| TPSA | 162.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.65 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|