C15H19IO4 — CID 166439341
ethyl (E,4R)-4-(2-iodo-3-methoxyphenoxy)-3-methylpent-2-enoate (PubChem CID 166439341) has the molecular formula C15H19IO4 and a molecular weight of 390.22 g/mol. Its IUPAC name is ethyl (E,4R)-4-(2-iodo-3-methoxyphenoxy)-3-methylpent-2-enoate.
| Compound Name | ethyl (E,4R)-4-(2-iodo-3-methoxyphenoxy)-3-methylpent-2-enoate |
|---|---|
| PubChem CID | 166439341 |
| Molecular Formula | C15H19IO4 |
| Molecular Weight | 390.22 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | ethyl (E,4R)-4-(2-iodo-3-methoxyphenoxy)-3-methylpent-2-enoate |
| SMILES | CCOC(=O)/C=C(\C)[C@@H](C)Oc1cccc(OC)c1I |
| InChI | InChI=1S/C15H19IO4/c1-5-19-14(17)9-10(2)11(3)20-13-8-6-7-12(18-4)15(13)16/h6-9,11H,5H2,1-4H3/b10-9+/t11-/m1/s1 |
| InChIKey | AIBPPCJMISZOIZ-PBQZMEPESA-N |
| XLogP | 3.58 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.22 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|