C11H24N2 — CID 139366079
1-[(3R)-2-ethenyl-3-methylpentyl]-1,2,2-trimethylhydrazine (PubChem CID 139366079) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is 1-[(3R)-2-ethenyl-3-methylpentyl]-1,2,2-trimethylhydrazine.
| Compound Name | 1-[(3R)-2-ethenyl-3-methylpentyl]-1,2,2-trimethylhydrazine |
|---|---|
| PubChem CID | 139366079 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | 1-[(3R)-2-ethenyl-3-methylpentyl]-1,2,2-trimethylhydrazine |
| SMILES | C=CC(CN(C)N(C)C)[C@H](C)CC |
| InChI | InChI=1S/C11H24N2/c1-7-10(3)11(8-2)9-13(6)12(4)5/h8,10-11H,2,7,9H2,1,3-6H3/t10-,11?/m1/s1 |
| InChIKey | RLBBDTVIWJDPMW-NFJWQWPMSA-N |
| XLogP | 2.24 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|