C12H24N2 — CID 28596727
(2S,3R)-3-methyl-1-N,1-N-bis(prop-2-enyl)pentane-1,2-diamine (PubChem CID 28596727) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is (2S,3R)-3-methyl-1-N,1-N-bis(prop-2-enyl)pentane-1,2-diamine.
| Compound Name | (2S,3R)-3-methyl-1-N,1-N-bis(prop-2-enyl)pentane-1,2-diamine |
|---|---|
| PubChem CID | 28596727 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | (2S,3R)-3-methyl-1-N,1-N-bis(prop-2-enyl)pentane-1,2-diamine |
| SMILES | C=CCN(CC=C)C[C@@H](N)[C@H](C)CC |
| InChI | InChI=1S/C12H24N2/c1-5-8-14(9-6-2)10-12(13)11(4)7-3/h5-6,11-12H,1-2,7-10,13H2,3-4H3/t11-,12-/m1/s1 |
| InChIKey | URHPXJCBQKMYLA-VXGBXAGGSA-N |
| XLogP | 2.03 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|