C11H22N2 — CID 21275121
N,N'-diethyl-N,N'-bis(prop-2-enyl)methanediamine (PubChem CID 21275121) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is N,N'-diethyl-N,N'-bis(prop-2-enyl)methanediamine.
| Compound Name | N,N'-diethyl-N,N'-bis(prop-2-enyl)methanediamine |
|---|---|
| PubChem CID | 21275121 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | N,N'-diethyl-N,N'-bis(prop-2-enyl)methanediamine |
| SMILES | C=CCN(CC)CN(CC)CC=C |
| InChI | InChI=1S/C11H22N2/c1-5-9-12(7-3)11-13(8-4)10-6-2/h5-6H,1-2,7-11H2,3-4H3 |
| InChIKey | HHTBJRCNRRPLDC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|