C27H56 — CID 123281462
2,3,6,7,8,13,14-heptamethyl-9-propylheptadecane (PubChem CID 123281462) has the molecular formula C27H56 and a molecular weight of 380.75 g/mol. Its IUPAC name is 2,3,6,7,8,13,14-heptamethyl-9-propylheptadecane.
| Compound Name | 2,3,6,7,8,13,14-heptamethyl-9-propylheptadecane |
|---|---|
| PubChem CID | 123281462 |
| Molecular Formula | C27H56 |
| Molecular Weight | 380.75 g/mol |
| Exact Mass | 380.44 |
| IUPAC Name | 2,3,6,7,8,13,14-heptamethyl-9-propylheptadecane |
| SMILES | CCCC(C)C(C)CCCC(CCC)C(C)C(C)C(C)CCC(C)C(C)C |
| InChI | InChI=1S/C27H56/c1-11-14-22(6)23(7)16-13-17-27(15-12-2)26(10)25(9)24(8)19-18-21(5)20(3)4/h20-27H,11-19H2,1-10H3 |
| InChIKey | KAGVHXSAEPRWLY-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.75 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |