C22H46 — CID 123402203
9-ethyl-2,3,4-trimethyl-5-propyltetradecane (PubChem CID 123402203) has the molecular formula C22H46 and a molecular weight of 310.61 g/mol. Its IUPAC name is 9-ethyl-2,3,4-trimethyl-5-propyltetradecane.
| Compound Name | 9-ethyl-2,3,4-trimethyl-5-propyltetradecane |
|---|---|
| PubChem CID | 123402203 |
| Molecular Formula | C22H46 |
| Molecular Weight | 310.61 g/mol |
| Exact Mass | 310.36 |
| IUPAC Name | 9-ethyl-2,3,4-trimethyl-5-propyltetradecane |
| SMILES | CCCCCC(CC)CCCC(CCC)C(C)C(C)C(C)C |
| InChI | InChI=1S/C22H46/c1-8-11-12-15-21(10-3)16-13-17-22(14-9-2)20(7)19(6)18(4)5/h18-22H,8-17H2,1-7H3 |
| InChIKey | JREBRELABPUCAU-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.61 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|