About tributyl(4,4-dichlorobutyl)azanium chloride
tributyl(4,4-dichlorobutyl)azanium chloride (PubChem CID 158270189) has the molecular formula C16H34Cl3N
and a molecular weight of 346.81 g/mol. Its IUPAC name is tributyl(4,4-dichlorobutyl)azanium chloride.
Molecular Properties
| Compound Name | tributyl(4,4-dichlorobutyl)azanium chloride |
| PubChem CID | 158270189 |
| Molecular Formula | C16H34Cl3N |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | tributyl(4,4-dichlorobutyl)azanium chloride |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC(Cl)Cl.[Cl-] |
| InChI | InChI=1S/C16H34Cl2N.ClH/c1-4-7-12-19(13-8-5-2,14-9-6-3)15-10-11-16(17)18;/h16H,4-15H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | GIXWZRMMJSLOFU-UHFFFAOYSA-M |
| XLogP | 2.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze tributyl(4,4-dichlorobutyl)azanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl(4,4-dichlorobutyl)azanium chloride?
The IUPAC name of tributyl(4,4-dichlorobutyl)azanium chloride (CID 158270189) is tributyl(4,4-dichlorobutyl)azanium chloride.
What is the SMILES notation for tributyl(4,4-dichlorobutyl)azanium chloride?
The canonical SMILES for tributyl(4,4-dichlorobutyl)azanium chloride is CCCC[N+](CCCC)(CCCC)CCCC(Cl)Cl.[Cl-].
What is the InChIKey of tributyl(4,4-dichlorobutyl)azanium chloride?
The InChIKey is GIXWZRMMJSLOFU-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H34Cl2N.ClH/c1-4-7-12-19(13-8-5-2,14-9-6-3)15-10-11-16(17)18;/h16H,4-15H2,1-3H3;1H/q+1;/p-1.
What are the key properties of tributyl(4,4-dichlorobutyl)azanium chloride?
tributyl(4,4-dichlorobutyl)azanium chloride has a molecular weight of 346.81 g/mol, XLogP of 2.79, 13 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl(4,4-dichlorobutyl)azanium chloride is sourced from PubChem (CID 158270189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).