About alumane;butyl(4,4-dichlorobutyl)alumane
alumane;butyl(4,4-dichlorobutyl)alumane (PubChem CID 175059334) has the molecular formula C8H20Al2Cl2
and a molecular weight of 241.12 g/mol. Its IUPAC name is alumane;butyl(4,4-dichlorobutyl)alumane.
Molecular Properties
| Compound Name | alumane;butyl(4,4-dichlorobutyl)alumane |
| PubChem CID | 175059334 |
| Molecular Formula | C8H20Al2Cl2 |
| Molecular Weight | 241.12 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | alumane;butyl(4,4-dichlorobutyl)alumane |
| SMILES | CCCC[AlH]CCCC(Cl)Cl.[AlH3] |
| InChI | InChI=1S/C4H7Cl2.C4H9.2Al.4H/c1-2-3-4(5)6;1-3-4-2;;;;;;/h4H,1-3H2;1,3-4H2,2H3;;;;;; |
| InChIKey | DRCSKBFQLFOTDY-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.12 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze alumane;butyl(4,4-dichlorobutyl)alumane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alumane;butyl(4,4-dichlorobutyl)alumane?
The IUPAC name of alumane;butyl(4,4-dichlorobutyl)alumane (CID 175059334) is alumane;butyl(4,4-dichlorobutyl)alumane.
What is the SMILES notation for alumane;butyl(4,4-dichlorobutyl)alumane?
The canonical SMILES for alumane;butyl(4,4-dichlorobutyl)alumane is CCCC[AlH]CCCC(Cl)Cl.[AlH3].
What is the InChIKey of alumane;butyl(4,4-dichlorobutyl)alumane?
The InChIKey is DRCSKBFQLFOTDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7Cl2.C4H9.2Al.4H/c1-2-3-4(5)6;1-3-4-2;;;;;;/h4H,1-3H2;1,3-4H2,2H3;;;;;;.
What are the key properties of alumane;butyl(4,4-dichlorobutyl)alumane?
alumane;butyl(4,4-dichlorobutyl)alumane has a molecular weight of 241.12 g/mol, XLogP of 2.46, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for alumane;butyl(4,4-dichlorobutyl)alumane is sourced from PubChem (CID 175059334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).