C16H23NO6 — CID 177410144
(2S,3R,4R,5R)-N-benzyl-2,4,5,6-tetrahydroxy-3-prop-2-enoxyhexan-1-imine oxide (PubChem CID 177410144) has the molecular formula C16H23NO6 and a molecular weight of 325.36 g/mol. Its IUPAC name is (2S,3R,4R,5R)-N-benzyl-2,4,5,6-tetrahydroxy-3-prop-2-enoxyhexan-1-imine oxide.
| Compound Name | (2S,3R,4R,5R)-N-benzyl-2,4,5,6-tetrahydroxy-3-prop-2-enoxyhexan-1-imine oxide |
|---|---|
| PubChem CID | 177410144 |
| Molecular Formula | C16H23NO6 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | (2S,3R,4R,5R)-N-benzyl-2,4,5,6-tetrahydroxy-3-prop-2-enoxyhexan-1-imine oxide |
| SMILES | C=CCO[C@@H]([C@H](O)[C@H](O)CO)[C@@H](O)/C=[N+](\[O-])Cc1ccccc1 |
| InChI | InChI=1S/C16H23NO6/c1-2-8-23-16(15(21)14(20)11-18)13(19)10-17(22)9-12-6-4-3-5-7-12/h2-7,10,13-16,18-21H,1,8-9,11H2/b17-10-/t13-,14+,15+,16+/m0/s1 |
| InChIKey | LHNGZEJEOJHKSK-HETGAOIISA-N |
| XLogP | -0.59 |
| TPSA | 116.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|