C24H25NO3 — CID 11394741
(2S)-N-benzyl-2,3-bis(phenylmethoxy)propan-1-imine oxide (PubChem CID 11394741) has the molecular formula C24H25NO3 and a molecular weight of 375.47 g/mol. Its IUPAC name is (2S)-N-benzyl-2,3-bis(phenylmethoxy)propan-1-imine oxide.
| Compound Name | (2S)-N-benzyl-2,3-bis(phenylmethoxy)propan-1-imine oxide |
|---|---|
| PubChem CID | 11394741 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | (2S)-N-benzyl-2,3-bis(phenylmethoxy)propan-1-imine oxide |
| SMILES | [O-]/[N+](=C\[C@@H](COCc1ccccc1)OCc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H25NO3/c26-25(16-21-10-4-1-5-11-21)17-24(28-19-23-14-8-3-9-15-23)20-27-18-22-12-6-2-7-13-22/h1-15,17,24H,16,18-20H2/b25-17-/t24-/m0/s1 |
| InChIKey | ZJCXIFKXSNJGLC-FDJRJZQMSA-N |
| XLogP | 4.57 |
| TPSA | 44.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|