C10H16Br2O — CID 102410954
(4S,5S)-5-(2,2-dibromoethenyl)oct-7-en-4-ol (PubChem CID 102410954) has the molecular formula C10H16Br2O and a molecular weight of 312.05 g/mol. Its IUPAC name is (4S,5S)-5-(2,2-dibromoethenyl)oct-7-en-4-ol.
| Compound Name | (4S,5S)-5-(2,2-dibromoethenyl)oct-7-en-4-ol |
|---|---|
| PubChem CID | 102410954 |
| Molecular Formula | C10H16Br2O |
| Molecular Weight | 312.05 g/mol |
| Exact Mass | 309.96 |
| IUPAC Name | (4S,5S)-5-(2,2-dibromoethenyl)oct-7-en-4-ol |
| SMILES | C=CCC(C=C(Br)Br)[C@@H](O)CCC |
| InChI | InChI=1S/C10H16Br2O/c1-3-5-8(7-10(11)12)9(13)6-4-2/h3,7-9,13H,1,4-6H2,2H3/t8?,9-/m0/s1 |
| InChIKey | MYPVBHTVQHPXHY-GKAPJAKFSA-N |
| XLogP | 3.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.05 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|