C9H17ClO — CID 134883041
(3S,4R)-3-(2-chloroethyl)hept-1-en-4-ol (PubChem CID 134883041) has the molecular formula C9H17ClO and a molecular weight of 176.69 g/mol. Its IUPAC name is (3S,4R)-3-(2-chloroethyl)hept-1-en-4-ol.
| Compound Name | (3S,4R)-3-(2-chloroethyl)hept-1-en-4-ol |
|---|---|
| PubChem CID | 134883041 |
| Molecular Formula | C9H17ClO |
| Molecular Weight | 176.69 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | (3S,4R)-3-(2-chloroethyl)hept-1-en-4-ol |
| SMILES | C=C[C@H](CCCl)[C@H](O)CCC |
| InChI | InChI=1S/C9H17ClO/c1-3-5-9(11)8(4-2)6-7-10/h4,8-9,11H,2-3,5-7H2,1H3/t8-,9-/m1/s1 |
| InChIKey | SVLJLQQPCOOWDU-RKDXNWHRSA-N |
| XLogP | 2.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.69 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|