About dimethyltin;1-propoxypropan-1-ol
dimethyltin;1-propoxypropan-1-ol (PubChem CID 174652896) has the molecular formula C8H20O2Sn
and a molecular weight of 266.96 g/mol. Its IUPAC name is dimethyltin;1-propoxypropan-1-ol.
Molecular Properties
| Compound Name | dimethyltin;1-propoxypropan-1-ol |
| PubChem CID | 174652896 |
| Molecular Formula | C8H20O2Sn |
| Molecular Weight | 266.96 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | dimethyltin;1-propoxypropan-1-ol |
| SMILES | CCCOC(O)CC.C[Sn]C |
| InChI | InChI=1S/C6H14O2.2CH3.Sn/c1-3-5-8-6(7)4-2;;;/h6-7H,3-5H2,1-2H3;2*1H3; |
| InChIKey | WMNDONLSJVFBLJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.96 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze dimethyltin;1-propoxypropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyltin;1-propoxypropan-1-ol?
The IUPAC name of dimethyltin;1-propoxypropan-1-ol (CID 174652896) is dimethyltin;1-propoxypropan-1-ol.
What is the SMILES notation for dimethyltin;1-propoxypropan-1-ol?
The canonical SMILES for dimethyltin;1-propoxypropan-1-ol is CCCOC(O)CC.C[Sn]C.
What is the InChIKey of dimethyltin;1-propoxypropan-1-ol?
The InChIKey is WMNDONLSJVFBLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O2.2CH3.Sn/c1-3-5-8-6(7)4-2;;;/h6-7H,3-5H2,1-2H3;2*1H3;.
What are the key properties of dimethyltin;1-propoxypropan-1-ol?
dimethyltin;1-propoxypropan-1-ol has a molecular weight of 266.96 g/mol, XLogP of 1.93, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyltin;1-propoxypropan-1-ol is sourced from PubChem (CID 174652896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).