About butoxy-(1,2-diamino-2-ethoxyethoxy)-oxophosphanium
butoxy-(1,2-diamino-2-ethoxyethoxy)-oxophosphanium (PubChem CID 175143094) has the molecular formula C8H20N2O4P+
and a molecular weight of 239.23 g/mol. Its IUPAC name is butoxy-(1,2-diamino-2-ethoxyethoxy)-oxophosphanium.
Molecular Properties
| Compound Name | butoxy-(1,2-diamino-2-ethoxyethoxy)-oxophosphanium |
| PubChem CID | 175143094 |
| Molecular Formula | C8H20N2O4P+ |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | butoxy-(1,2-diamino-2-ethoxyethoxy)-oxophosphanium |
| SMILES | CCCCO[P+](=O)OC(N)C(N)OCC |
| InChI | InChI=1S/C8H20N2O4P/c1-3-5-6-13-15(11)14-8(10)7(9)12-4-2/h7-8H,3-6,9-10H2,1-2H3/q+1 |
| InChIKey | SVQWGTXPUCPBQT-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze butoxy-(1,2-diamino-2-ethoxyethoxy)-oxophosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butoxy-(1,2-diamino-2-ethoxyethoxy)-oxophosphanium?
The IUPAC name of butoxy-(1,2-diamino-2-ethoxyethoxy)-oxophosphanium (CID 175143094) is butoxy-(1,2-diamino-2-ethoxyethoxy)-oxophosphanium.
What is the SMILES notation for butoxy-(1,2-diamino-2-ethoxyethoxy)-oxophosphanium?
The canonical SMILES for butoxy-(1,2-diamino-2-ethoxyethoxy)-oxophosphanium is CCCCO[P+](=O)OC(N)C(N)OCC.
What is the InChIKey of butoxy-(1,2-diamino-2-ethoxyethoxy)-oxophosphanium?
The InChIKey is SVQWGTXPUCPBQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20N2O4P/c1-3-5-6-13-15(11)14-8(10)7(9)12-4-2/h7-8H,3-6,9-10H2,1-2H3/q+1.
What are the key properties of butoxy-(1,2-diamino-2-ethoxyethoxy)-oxophosphanium?
butoxy-(1,2-diamino-2-ethoxyethoxy)-oxophosphanium has a molecular weight of 239.23 g/mol, XLogP of 1.08, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for butoxy-(1,2-diamino-2-ethoxyethoxy)-oxophosphanium is sourced from PubChem (CID 175143094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).