C16H34Cl2O7P+ — CID 21493302
chloroethane;2-chloroethoxy-(1-hydroxy-1,2,2-tripropoxypropoxy)-oxophosphanium (PubChem CID 21493302) has the molecular formula C16H34Cl2O7P+ and a molecular weight of 440.32 g/mol. Its IUPAC name is chloroethane;2-chloroethoxy-(1-hydroxy-1,2,2-tripropoxypropoxy)-oxophosphanium.
| Compound Name | chloroethane;2-chloroethoxy-(1-hydroxy-1,2,2-tripropoxypropoxy)-oxophosphanium |
|---|---|
| PubChem CID | 21493302 |
| Molecular Formula | C16H34Cl2O7P+ |
| Molecular Weight | 440.32 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | chloroethane;2-chloroethoxy-(1-hydroxy-1,2,2-tripropoxypropoxy)-oxophosphanium |
| SMILES | CCCOC(C)(OCCC)C(O)(OCCC)O[P+](=O)OCCCl.CCCl |
| InChI | InChI=1S/C14H29ClO7P.C2H5Cl/c1-5-9-18-13(4,19-10-6-2)14(16,20-11-7-3)22-23(17)21-12-8-15;1-2-3/h16H,5-12H2,1-4H3;2H2,1H3/q+1; |
| InChIKey | SMTYOTOOCAPJOZ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.32 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|