C10H22Br2O6P+ — CID 21493300
bromoethane;2-bromoethoxy-(1,2-diethoxy-1-hydroxyethoxy)-oxophosphanium (PubChem CID 21493300) has the molecular formula C10H22Br2O6P+ and a molecular weight of 429.06 g/mol. Its IUPAC name is bromoethane;2-bromoethoxy-(1,2-diethoxy-1-hydroxyethoxy)-oxophosphanium.
| Compound Name | bromoethane;2-bromoethoxy-(1,2-diethoxy-1-hydroxyethoxy)-oxophosphanium |
|---|---|
| PubChem CID | 21493300 |
| Molecular Formula | C10H22Br2O6P+ |
| Molecular Weight | 429.06 g/mol |
| Exact Mass | 426.95 |
| IUPAC Name | bromoethane;2-bromoethoxy-(1,2-diethoxy-1-hydroxyethoxy)-oxophosphanium |
| SMILES | CCBr.CCOCC(O)(OCC)O[P+](=O)OCCBr |
| InChI | InChI=1S/C8H17BrO6P.C2H5Br/c1-3-12-7-8(10,13-4-2)15-16(11)14-6-5-9;1-2-3/h10H,3-7H2,1-2H3;2H2,1H3/q+1; |
| InChIKey | HYFDVRIFOQHZGS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.06 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|