C16H32Cl2O4 — CID 88830793
1-chloro-3-(chloromethyl)-6,6,6-tripropoxyhexan-3-ol (PubChem CID 88830793) has the molecular formula C16H32Cl2O4 and a molecular weight of 359.33 g/mol. Its IUPAC name is 1-chloro-3-(chloromethyl)-6,6,6-tripropoxyhexan-3-ol.
| Compound Name | 1-chloro-3-(chloromethyl)-6,6,6-tripropoxyhexan-3-ol |
|---|---|
| PubChem CID | 88830793 |
| Molecular Formula | C16H32Cl2O4 |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 1-chloro-3-(chloromethyl)-6,6,6-tripropoxyhexan-3-ol |
| SMILES | CCCOC(CCC(O)(CCl)CCCl)(OCCC)OCCC |
| InChI | InChI=1S/C16H32Cl2O4/c1-4-11-20-16(21-12-5-2,22-13-6-3)8-7-15(19,14-18)9-10-17/h19H,4-14H2,1-3H3 |
| InChIKey | GJKUPRZDYYQBIX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|