C16H36O5Si — CID 175067938
methoxymethoxy-dimethyl-(3,3,3-tripropoxypropyl)silane (PubChem CID 175067938) has the molecular formula C16H36O5Si and a molecular weight of 336.55 g/mol. Its IUPAC name is methoxymethoxy-dimethyl-(3,3,3-tripropoxypropyl)silane.
| Compound Name | methoxymethoxy-dimethyl-(3,3,3-tripropoxypropyl)silane |
|---|---|
| PubChem CID | 175067938 |
| Molecular Formula | C16H36O5Si |
| Molecular Weight | 336.55 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | methoxymethoxy-dimethyl-(3,3,3-tripropoxypropyl)silane |
| SMILES | CCCOC(CC[Si](C)(C)OCOC)(OCCC)OCCC |
| InChI | InChI=1S/C16H36O5Si/c1-7-11-18-16(19-12-8-2,20-13-9-3)10-14-22(5,6)21-15-17-4/h7-15H2,1-6H3 |
| InChIKey | SRZLBCJFUIFJEK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.55 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|