C12H28O4Si — CID 175337498
1,1-dipropoxypropyl-dimethoxy-methylsilane (PubChem CID 175337498) has the molecular formula C12H28O4Si and a molecular weight of 264.44 g/mol. Its IUPAC name is 1,1-dipropoxypropyl-dimethoxy-methylsilane.
| Compound Name | 1,1-dipropoxypropyl-dimethoxy-methylsilane |
|---|---|
| PubChem CID | 175337498 |
| Molecular Formula | C12H28O4Si |
| Molecular Weight | 264.44 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 1,1-dipropoxypropyl-dimethoxy-methylsilane |
| SMILES | CCCOC(CC)(OCCC)[Si](C)(OC)OC |
| InChI | InChI=1S/C12H28O4Si/c1-7-10-15-12(9-3,16-11-8-2)17(6,13-4)14-5/h7-11H2,1-6H3 |
| InChIKey | XPARDTTVWGUTIW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|