C20H44O5Si — CID 151824293
1-methoxyethoxy-dimethyl-(3,3,3-tributoxypropyl)silane (PubChem CID 151824293) has the molecular formula C20H44O5Si and a molecular weight of 392.65 g/mol. Its IUPAC name is 1-methoxyethoxy-dimethyl-(3,3,3-tributoxypropyl)silane.
| Compound Name | 1-methoxyethoxy-dimethyl-(3,3,3-tributoxypropyl)silane |
|---|---|
| PubChem CID | 151824293 |
| Molecular Formula | C20H44O5Si |
| Molecular Weight | 392.65 g/mol |
| Exact Mass | 392.30 |
| IUPAC Name | 1-methoxyethoxy-dimethyl-(3,3,3-tributoxypropyl)silane |
| SMILES | CCCCOC(CC[Si](C)(C)OC(C)OC)(OCCCC)OCCCC |
| InChI | InChI=1S/C20H44O5Si/c1-8-11-15-22-20(23-16-12-9-2,24-17-13-10-3)14-18-26(6,7)25-19(4)21-5/h19H,8-18H2,1-7H3 |
| InChIKey | SDGWXWGJWNJBFV-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.65 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|