C19H42O7Si — CID 151867618
dimethoxy-(methoxymethoxy)-(3,3,3-tributoxypropyl)silane (PubChem CID 151867618) has the molecular formula C19H42O7Si and a molecular weight of 410.62 g/mol. Its IUPAC name is dimethoxy-(methoxymethoxy)-(3,3,3-tributoxypropyl)silane.
| Compound Name | dimethoxy-(methoxymethoxy)-(3,3,3-tributoxypropyl)silane |
|---|---|
| PubChem CID | 151867618 |
| Molecular Formula | C19H42O7Si |
| Molecular Weight | 410.62 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | dimethoxy-(methoxymethoxy)-(3,3,3-tributoxypropyl)silane |
| SMILES | CCCCOC(CC[Si](OC)(OC)OCOC)(OCCCC)OCCCC |
| InChI | InChI=1S/C19H42O7Si/c1-7-10-14-23-19(24-15-11-8-2,25-16-12-9-3)13-17-27(21-5,22-6)26-18-20-4/h7-18H2,1-6H3 |
| InChIKey | SLZWFHFOTGVEJE-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.62 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|