C14H30HfO4 — CID 175773541
hafnium;2,2,2-tributoxyethanol (PubChem CID 175773541) has the molecular formula C14H30HfO4 and a molecular weight of 440.88 g/mol. Its IUPAC name is hafnium;2,2,2-tributoxyethanol.
| Compound Name | hafnium;2,2,2-tributoxyethanol |
|---|---|
| PubChem CID | 175773541 |
| Molecular Formula | C14H30HfO4 |
| Molecular Weight | 440.88 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | hafnium;2,2,2-tributoxyethanol |
| SMILES | CCCCOC(CO)(OCCCC)OCCCC.[Hf] |
| InChI | InChI=1S/C14H30O4.Hf/c1-4-7-10-16-14(13-15,17-11-8-5-2)18-12-9-6-3;/h15H,4-13H2,1-3H3; |
| InChIKey | ISTHQPXRXXLLLZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.88 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|