About carbanide;2,2-diheptoxypropan-1-ol;yttrium
carbanide;2,2-diheptoxypropan-1-ol;yttrium (PubChem CID 58517147) has the molecular formula C18H39O3Y-
and a molecular weight of 392.41 g/mol. Its IUPAC name is carbanide;2,2-diheptoxypropan-1-ol;yttrium.
Molecular Properties
| Compound Name | carbanide;2,2-diheptoxypropan-1-ol;yttrium |
| PubChem CID | 58517147 |
| Molecular Formula | C18H39O3Y- |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | carbanide;2,2-diheptoxypropan-1-ol;yttrium |
| SMILES | CCCCCCCOC(C)(CO)OCCCCCCC.[CH3-].[Y] |
| InChI | InChI=1S/C17H36O3.CH3.Y/c1-4-6-8-10-12-14-19-17(3,16-18)20-15-13-11-9-7-5-2;;/h18H,4-16H2,1-3H3;1H3;/q;-1; |
| InChIKey | XLUPVYOCSRXXEO-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze carbanide;2,2-diheptoxypropan-1-ol;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;2,2-diheptoxypropan-1-ol;yttrium?
The IUPAC name of carbanide;2,2-diheptoxypropan-1-ol;yttrium (CID 58517147) is carbanide;2,2-diheptoxypropan-1-ol;yttrium.
What is the SMILES notation for carbanide;2,2-diheptoxypropan-1-ol;yttrium?
The canonical SMILES for carbanide;2,2-diheptoxypropan-1-ol;yttrium is CCCCCCCOC(C)(CO)OCCCCCCC.[CH3-].[Y].
What is the InChIKey of carbanide;2,2-diheptoxypropan-1-ol;yttrium?
The InChIKey is XLUPVYOCSRXXEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H36O3.CH3.Y/c1-4-6-8-10-12-14-19-17(3,16-18)20-15-13-11-9-7-5-2;;/h18H,4-16H2,1-3H3;1H3;/q;-1;.
What are the key properties of carbanide;2,2-diheptoxypropan-1-ol;yttrium?
carbanide;2,2-diheptoxypropan-1-ol;yttrium has a molecular weight of 392.41 g/mol, XLogP of 5.12, 15 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;2,2-diheptoxypropan-1-ol;yttrium is sourced from PubChem (CID 58517147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).