C50H102O6S2 — CID 152551528
1,1,1-tributoxy-11-(13,13,13-tributoxytridecan-3-yldisulfanyl)tridecane (PubChem CID 152551528) has the molecular formula C50H102O6S2 and a molecular weight of 863.49 g/mol. Its IUPAC name is 1,1,1-tributoxy-11-(13,13,13-tributoxytridecan-3-yldisulfanyl)tridecane.
| Compound Name | 1,1,1-tributoxy-11-(13,13,13-tributoxytridecan-3-yldisulfanyl)tridecane |
|---|---|
| PubChem CID | 152551528 |
| Molecular Formula | C50H102O6S2 |
| Molecular Weight | 863.49 g/mol |
| Exact Mass | 862.71 |
| IUPAC Name | 1,1,1-tributoxy-11-(13,13,13-tributoxytridecan-3-yldisulfanyl)tridecane |
| SMILES | CCCCOC(CCCCCCCCCC(CC)SSC(CC)CCCCCCCCCC(OCCCC)(OCCCC)OCCCC)(OCCCC)OCCCC |
| InChI | InChI=1S/C50H102O6S2/c1-9-17-41-51-49(52-42-18-10-2,53-43-19-11-3)39-35-31-27-23-25-29-33-37-47(15-7)57-58-48(16-8)38-34-30-26-24-28-32-36-40-50(54-44-20-12-4,55-45-21-13-5)56-46-22-14-6/h47-48H,9-46H2,1-8H3 |
| InChIKey | YNOXYEBCJADSHV-UHFFFAOYSA-N |
| XLogP | 17.15 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.49 |
| LogP ≤ 5 | 17.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|