C23H48O3S2 — CID 151121902
2-(10,10,10-tripropoxydecyl)butane-1,4-dithiol (PubChem CID 151121902) has the molecular formula C23H48O3S2 and a molecular weight of 436.77 g/mol. Its IUPAC name is 2-(10,10,10-tripropoxydecyl)butane-1,4-dithiol.
| Compound Name | 2-(10,10,10-tripropoxydecyl)butane-1,4-dithiol |
|---|---|
| PubChem CID | 151121902 |
| Molecular Formula | C23H48O3S2 |
| Molecular Weight | 436.77 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | 2-(10,10,10-tripropoxydecyl)butane-1,4-dithiol |
| SMILES | CCCOC(CCCCCCCCCC(CS)CCS)(OCCC)OCCC |
| InChI | InChI=1S/C23H48O3S2/c1-4-17-24-23(25-18-5-2,26-19-6-3)16-13-11-9-7-8-10-12-14-22(21-28)15-20-27/h22,27-28H,4-21H2,1-3H3 |
| InChIKey | MSJFSRQUPWHWIJ-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 27.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.77 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|