C28H56O5 — CID 152665625
2-[(10,10,10-tributoxy-4-propyldecoxy)methyl]oxirane (PubChem CID 152665625) has the molecular formula C28H56O5 and a molecular weight of 472.75 g/mol. Its IUPAC name is 2-[(10,10,10-tributoxy-4-propyldecoxy)methyl]oxirane.
| Compound Name | 2-[(10,10,10-tributoxy-4-propyldecoxy)methyl]oxirane |
|---|---|
| PubChem CID | 152665625 |
| Molecular Formula | C28H56O5 |
| Molecular Weight | 472.75 g/mol |
| Exact Mass | 472.41 |
| IUPAC Name | 2-[(10,10,10-tributoxy-4-propyldecoxy)methyl]oxirane |
| SMILES | CCCCOC(CCCCCC(CCC)CCCOCC1CO1)(OCCCC)OCCCC |
| InChI | InChI=1S/C28H56O5/c1-5-9-21-31-28(32-22-10-6-2,33-23-11-7-3)19-14-12-13-17-26(16-8-4)18-15-20-29-24-27-25-30-27/h26-27H,5-25H2,1-4H3 |
| InChIKey | ZKLGMRMYFJTMAP-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.75 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|