C22H46O3 — CID 150375799
1,1,1-triethoxy-11-ethyltetradecane (PubChem CID 150375799) has the molecular formula C22H46O3 and a molecular weight of 358.61 g/mol. Its IUPAC name is 1,1,1-triethoxy-11-ethyltetradecane.
| Compound Name | 1,1,1-triethoxy-11-ethyltetradecane |
|---|---|
| PubChem CID | 150375799 |
| Molecular Formula | C22H46O3 |
| Molecular Weight | 358.61 g/mol |
| Exact Mass | 358.34 |
| IUPAC Name | 1,1,1-triethoxy-11-ethyltetradecane |
| SMILES | CCCC(CC)CCCCCCCCCC(OCC)(OCC)OCC |
| InChI | InChI=1S/C22H46O3/c1-6-18-21(7-2)19-16-14-12-11-13-15-17-20-22(23-8-3,24-9-4)25-10-5/h21H,6-20H2,1-5H3 |
| InChIKey | GYQZPEWJCDQQCQ-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.61 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|