C16H35NO3S — CID 151796359
1-amino-10,10,10-triethoxydecane-3-thiol (PubChem CID 151796359) has the molecular formula C16H35NO3S and a molecular weight of 321.53 g/mol. Its IUPAC name is 1-amino-10,10,10-triethoxydecane-3-thiol.
| Compound Name | 1-amino-10,10,10-triethoxydecane-3-thiol |
|---|---|
| PubChem CID | 151796359 |
| Molecular Formula | C16H35NO3S |
| Molecular Weight | 321.53 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | 1-amino-10,10,10-triethoxydecane-3-thiol |
| SMILES | CCOC(CCCCCCC(S)CCN)(OCC)OCC |
| InChI | InChI=1S/C16H35NO3S/c1-4-18-16(19-5-2,20-6-3)13-10-8-7-9-11-15(21)12-14-17/h15,21H,4-14,17H2,1-3H3 |
| InChIKey | RXRFEKCAEBRBOK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.53 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|