C18H39NO3 — CID 150559594
3-(2,2,2-triethoxyethyl)decan-1-amine (PubChem CID 150559594) has the molecular formula C18H39NO3 and a molecular weight of 317.51 g/mol. Its IUPAC name is 3-(2,2,2-triethoxyethyl)decan-1-amine.
| Compound Name | 3-(2,2,2-triethoxyethyl)decan-1-amine |
|---|---|
| PubChem CID | 150559594 |
| Molecular Formula | C18H39NO3 |
| Molecular Weight | 317.51 g/mol |
| Exact Mass | 317.29 |
| IUPAC Name | 3-(2,2,2-triethoxyethyl)decan-1-amine |
| SMILES | CCCCCCCC(CCN)CC(OCC)(OCC)OCC |
| InChI | InChI=1S/C18H39NO3/c1-5-9-10-11-12-13-17(14-15-19)16-18(20-6-2,21-7-3)22-8-4/h17H,5-16,19H2,1-4H3 |
| InChIKey | IJOGGHVNQZBJCJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.51 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|