C19H38O4 — CID 150810677
1,1,1-triethoxy-3-prop-1-enoxydecane (PubChem CID 150810677) has the molecular formula C19H38O4 and a molecular weight of 330.51 g/mol. Its IUPAC name is 1,1,1-triethoxy-3-prop-1-enoxydecane.
| Compound Name | 1,1,1-triethoxy-3-prop-1-enoxydecane |
|---|---|
| PubChem CID | 150810677 |
| Molecular Formula | C19H38O4 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.28 |
| IUPAC Name | 1,1,1-triethoxy-3-prop-1-enoxydecane |
| SMILES | CC=COC(CCCCCCC)CC(OCC)(OCC)OCC |
| InChI | InChI=1S/C19H38O4/c1-6-11-12-13-14-15-18(20-16-7-2)17-19(21-8-3,22-9-4)23-10-5/h7,16,18H,6,8-15,17H2,1-5H3 |
| InChIKey | KHUZDDCSEKAKHT-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|