C20H40O4 — CID 150907200
4-(2,2,2-triethoxy-1-methoxyethyl)undec-2-ene (PubChem CID 150907200) has the molecular formula C20H40O4 and a molecular weight of 344.54 g/mol. Its IUPAC name is 4-(2,2,2-triethoxy-1-methoxyethyl)undec-2-ene.
| Compound Name | 4-(2,2,2-triethoxy-1-methoxyethyl)undec-2-ene |
|---|---|
| PubChem CID | 150907200 |
| Molecular Formula | C20H40O4 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.29 |
| IUPAC Name | 4-(2,2,2-triethoxy-1-methoxyethyl)undec-2-ene |
| SMILES | CC=CC(CCCCCCC)C(OC)C(OCC)(OCC)OCC |
| InChI | InChI=1S/C20H40O4/c1-7-12-13-14-15-17-18(16-8-2)19(21-6)20(22-9-3,23-10-4)24-11-5/h8,16,18-19H,7,9-15,17H2,1-6H3 |
| InChIKey | LBFPXPIEYVUATE-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|