C34H70O9 — CID 175173883
1,1-dibutoxy-1-[1-[1-(1,1-dibutoxypentoxy)propoxymethoxymethoxy]propoxy]pentane (PubChem CID 175173883) has the molecular formula C34H70O9 and a molecular weight of 622.93 g/mol. Its IUPAC name is 1,1-dibutoxy-1-[1-[1-(1,1-dibutoxypentoxy)propoxymethoxymethoxy]propoxy]pentane.
| Compound Name | 1,1-dibutoxy-1-[1-[1-(1,1-dibutoxypentoxy)propoxymethoxymethoxy]propoxy]pentane |
|---|---|
| PubChem CID | 175173883 |
| Molecular Formula | C34H70O9 |
| Molecular Weight | 622.93 g/mol |
| Exact Mass | 622.50 |
| IUPAC Name | 1,1-dibutoxy-1-[1-[1-(1,1-dibutoxypentoxy)propoxymethoxymethoxy]propoxy]pentane |
| SMILES | CCCCOC(CCCC)(OCCCC)OC(CC)OCOCOC(CC)OC(CCCC)(OCCCC)OCCCC |
| InChI | InChI=1S/C34H70O9/c1-9-17-23-33(38-25-19-11-3,39-26-20-12-4)42-31(15-7)36-29-35-30-37-32(16-8)43-34(24-18-10-2,40-27-21-13-5)41-28-22-14-6/h31-32H,9-30H2,1-8H3 |
| InChIKey | URSRDLJORSIYCV-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.93 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|