C20H42O2 — CID 152500539
5,6-dibutoxy-5,6-dimethyldecane (PubChem CID 152500539) has the molecular formula C20H42O2 and a molecular weight of 314.55 g/mol. Its IUPAC name is 5,6-dibutoxy-5,6-dimethyldecane.
| Compound Name | 5,6-dibutoxy-5,6-dimethyldecane |
|---|---|
| PubChem CID | 152500539 |
| Molecular Formula | C20H42O2 |
| Molecular Weight | 314.55 g/mol |
| Exact Mass | 314.32 |
| IUPAC Name | 5,6-dibutoxy-5,6-dimethyldecane |
| SMILES | CCCCOC(C)(CCCC)C(C)(CCCC)OCCCC |
| InChI | InChI=1S/C20H42O2/c1-7-11-15-19(5,21-17-13-9-3)20(6,16-12-8-2)22-18-14-10-4/h7-18H2,1-6H3 |
| InChIKey | YDJGASAQXBTHGC-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.55 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|