C12H27NO — CID 138567145
3-[(3S)-2,2,3-trimethylhexan-3-yl]oxypropan-1-amine (PubChem CID 138567145) has the molecular formula C12H27NO and a molecular weight of 201.35 g/mol. Its IUPAC name is 3-[(3S)-2,2,3-trimethylhexan-3-yl]oxypropan-1-amine.
| Compound Name | 3-[(3S)-2,2,3-trimethylhexan-3-yl]oxypropan-1-amine |
|---|---|
| PubChem CID | 138567145 |
| Molecular Formula | C12H27NO |
| Molecular Weight | 201.35 g/mol |
| Exact Mass | 201.21 |
| IUPAC Name | 3-[(3S)-2,2,3-trimethylhexan-3-yl]oxypropan-1-amine |
| SMILES | CCC[C@](C)(OCCCN)C(C)(C)C |
| InChI | InChI=1S/C12H27NO/c1-6-8-12(5,11(2,3)4)14-10-7-9-13/h6-10,13H2,1-5H3/t12-/m0/s1 |
| InChIKey | DYFAEFVALIUAPR-LBPRGKRZSA-N |
| XLogP | 2.96 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|