C28H24Cl2O3P+ — CID 57020602
bis(2-chloro-2,2-diphenylethoxy)-oxophosphanium (PubChem CID 57020602) has the molecular formula C28H24Cl2O3P+ and a molecular weight of 510.38 g/mol. Its IUPAC name is bis(2-chloro-2,2-diphenylethoxy)-oxophosphanium.
| Compound Name | bis(2-chloro-2,2-diphenylethoxy)-oxophosphanium |
|---|---|
| PubChem CID | 57020602 |
| Molecular Formula | C28H24Cl2O3P+ |
| Molecular Weight | 510.38 g/mol |
| Exact Mass | 509.08 |
| IUPAC Name | bis(2-chloro-2,2-diphenylethoxy)-oxophosphanium |
| SMILES | O=[P+](OCC(Cl)(c1ccccc1)c1ccccc1)OCC(Cl)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H24Cl2O3P/c29-27(23-13-5-1-6-14-23,24-15-7-2-8-16-24)21-32-34(31)33-22-28(30,25-17-9-3-10-18-25)26-19-11-4-12-20-26/h1-20H,21-22H2/q+1 |
| InChIKey | UTSVZMMMSOSOOK-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.38 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|