C8H7F3O3P+ — CID 157259236
oxo-phenoxy-(2,2,2-trifluoroethoxy)phosphanium (PubChem CID 157259236) has the molecular formula C8H7F3O3P+ and a molecular weight of 239.11 g/mol. Its IUPAC name is oxo-phenoxy-(2,2,2-trifluoroethoxy)phosphanium.
| Compound Name | oxo-phenoxy-(2,2,2-trifluoroethoxy)phosphanium |
|---|---|
| PubChem CID | 157259236 |
| Molecular Formula | C8H7F3O3P+ |
| Molecular Weight | 239.11 g/mol |
| Exact Mass | 239.01 |
| IUPAC Name | oxo-phenoxy-(2,2,2-trifluoroethoxy)phosphanium |
| SMILES | O=[P+](OCC(F)(F)F)Oc1ccccc1 |
| InChI | InChI=1S/C8H7F3O3P/c9-8(10,11)6-13-15(12)14-7-4-2-1-3-5-7/h1-5H,6H2/q+1 |
| InChIKey | QAGBVIVFIJHHSS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.11 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|