About copper(1+);oxido-oxo-phenoxyphosphanium
copper(1+);oxido-oxo-phenoxyphosphanium (PubChem CID 166721703) has the molecular formula C6H5CuO3P+
and a molecular weight of 219.62 g/mol. Its IUPAC name is copper(1+);oxido-oxo-phenoxyphosphanium.
Molecular Properties
| Compound Name | copper(1+);oxido-oxo-phenoxyphosphanium |
| PubChem CID | 166721703 |
| Molecular Formula | C6H5CuO3P+ |
| Molecular Weight | 219.62 g/mol |
| Exact Mass | 218.93 |
| IUPAC Name | copper(1+);oxido-oxo-phenoxyphosphanium |
| SMILES | O=[P+]([O-])Oc1ccccc1.[Cu+] |
| InChI | InChI=1S/C6H5O3P.Cu/c7-10(8)9-6-4-2-1-3-5-6;/h1-5H;/q;+1 |
| InChIKey | YPBTWJAHDLFPTK-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.62 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze copper(1+);oxido-oxo-phenoxyphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper(1+);oxido-oxo-phenoxyphosphanium?
The IUPAC name of copper(1+);oxido-oxo-phenoxyphosphanium (CID 166721703) is copper(1+);oxido-oxo-phenoxyphosphanium.
What is the SMILES notation for copper(1+);oxido-oxo-phenoxyphosphanium?
The canonical SMILES for copper(1+);oxido-oxo-phenoxyphosphanium is O=[P+]([O-])Oc1ccccc1.[Cu+].
What is the InChIKey of copper(1+);oxido-oxo-phenoxyphosphanium?
The InChIKey is YPBTWJAHDLFPTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5O3P.Cu/c7-10(8)9-6-4-2-1-3-5-6;/h1-5H;/q;+1.
What are the key properties of copper(1+);oxido-oxo-phenoxyphosphanium?
copper(1+);oxido-oxo-phenoxyphosphanium has a molecular weight of 219.62 g/mol, XLogP of 1.08, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for copper(1+);oxido-oxo-phenoxyphosphanium is sourced from PubChem (CID 166721703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).