About oxido-oxo-phenoxyphosphanium;zirconium(4+);phosphate
oxido-oxo-phenoxyphosphanium;zirconium(4+);phosphate (PubChem CID 90015244) has the molecular formula C6H5O7P2Zr+
and a molecular weight of 342.27 g/mol. Its IUPAC name is oxido-oxo-phenoxyphosphanium;zirconium(4+);phosphate.
Molecular Properties
| Compound Name | oxido-oxo-phenoxyphosphanium;zirconium(4+);phosphate |
| PubChem CID | 90015244 |
| Molecular Formula | C6H5O7P2Zr+ |
| Molecular Weight | 342.27 g/mol |
| Exact Mass | 340.86 |
| IUPAC Name | oxido-oxo-phenoxyphosphanium;zirconium(4+);phosphate |
| SMILES | O=P([O-])([O-])[O-].O=[P+]([O-])Oc1ccccc1.[Zr+4] |
| InChI | InChI=1S/C6H5O3P.H3O4P.Zr/c7-10(8)9-6-4-2-1-3-5-6;1-5(2,3)4;/h1-5H;(H3,1,2,3,4);/q;;+4/p-3 |
| InChIKey | IANNLGKVBODEGU-UHFFFAOYSA-K |
| XLogP | -1.74 |
| TPSA | 135.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.27 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze oxido-oxo-phenoxyphosphanium;zirconium(4+);phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxido-oxo-phenoxyphosphanium;zirconium(4+);phosphate?
The IUPAC name of oxido-oxo-phenoxyphosphanium;zirconium(4+);phosphate (CID 90015244) is oxido-oxo-phenoxyphosphanium;zirconium(4+);phosphate.
What is the SMILES notation for oxido-oxo-phenoxyphosphanium;zirconium(4+);phosphate?
The canonical SMILES for oxido-oxo-phenoxyphosphanium;zirconium(4+);phosphate is O=P([O-])([O-])[O-].O=[P+]([O-])Oc1ccccc1.[Zr+4].
What is the InChIKey of oxido-oxo-phenoxyphosphanium;zirconium(4+);phosphate?
The InChIKey is IANNLGKVBODEGU-UHFFFAOYSA-K. The full InChI is InChI=1S/C6H5O3P.H3O4P.Zr/c7-10(8)9-6-4-2-1-3-5-6;1-5(2,3)4;/h1-5H;(H3,1,2,3,4);/q;;+4/p-3.
What are the key properties of oxido-oxo-phenoxyphosphanium;zirconium(4+);phosphate?
oxido-oxo-phenoxyphosphanium;zirconium(4+);phosphate has a molecular weight of 342.27 g/mol, XLogP of -1.74, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for oxido-oxo-phenoxyphosphanium;zirconium(4+);phosphate is sourced from PubChem (CID 90015244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).