About oxo-phenoxy-phosphonooxyphosphanium;zirconium
oxo-phenoxy-phosphonooxyphosphanium;zirconium (PubChem CID 90015245) has the molecular formula C6H7O6P2Zr+
and a molecular weight of 328.29 g/mol. Its IUPAC name is oxo-phenoxy-phosphonooxyphosphanium;zirconium.
Molecular Properties
| Compound Name | oxo-phenoxy-phosphonooxyphosphanium;zirconium |
| PubChem CID | 90015245 |
| Molecular Formula | C6H7O6P2Zr+ |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 326.88 |
| IUPAC Name | oxo-phenoxy-phosphonooxyphosphanium;zirconium |
| SMILES | O=[P+](Oc1ccccc1)OP(=O)(O)O.[Zr] |
| InChI | InChI=1S/C6H6O6P2.Zr/c7-13(12-14(8,9)10)11-6-4-2-1-3-5-6;/h1-5H,(H-,8,9,10);/p+1 |
| InChIKey | ZXOJRAPBOYOQPN-UHFFFAOYSA-O |
| XLogP | 1.83 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze oxo-phenoxy-phosphonooxyphosphanium;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxo-phenoxy-phosphonooxyphosphanium;zirconium?
The IUPAC name of oxo-phenoxy-phosphonooxyphosphanium;zirconium (CID 90015245) is oxo-phenoxy-phosphonooxyphosphanium;zirconium.
What is the SMILES notation for oxo-phenoxy-phosphonooxyphosphanium;zirconium?
The canonical SMILES for oxo-phenoxy-phosphonooxyphosphanium;zirconium is O=[P+](Oc1ccccc1)OP(=O)(O)O.[Zr].
What is the InChIKey of oxo-phenoxy-phosphonooxyphosphanium;zirconium?
The InChIKey is ZXOJRAPBOYOQPN-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H6O6P2.Zr/c7-13(12-14(8,9)10)11-6-4-2-1-3-5-6;/h1-5H,(H-,8,9,10);/p+1.
What are the key properties of oxo-phenoxy-phosphonooxyphosphanium;zirconium?
oxo-phenoxy-phosphonooxyphosphanium;zirconium has a molecular weight of 328.29 g/mol, XLogP of 1.83, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxo-phenoxy-phosphonooxyphosphanium;zirconium is sourced from PubChem (CID 90015245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).