About cobalt;oxo(diphenoxy)phosphanium
cobalt;oxo(diphenoxy)phosphanium (PubChem CID 162036820) has the molecular formula C12H10CoO3P+
and a molecular weight of 292.12 g/mol. Its IUPAC name is cobalt;oxo(diphenoxy)phosphanium.
Molecular Properties
| Compound Name | cobalt;oxo(diphenoxy)phosphanium |
| PubChem CID | 162036820 |
| Molecular Formula | C12H10CoO3P+ |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 291.97 |
| IUPAC Name | cobalt;oxo(diphenoxy)phosphanium |
| SMILES | O=[P+](Oc1ccccc1)Oc1ccccc1.[Co] |
| InChI | InChI=1S/C12H10O3P.Co/c13-16(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12;/h1-10H;/q+1; |
| InChIKey | DGEUYIDQQHDMEP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze cobalt;oxo(diphenoxy)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;oxo(diphenoxy)phosphanium?
The IUPAC name of cobalt;oxo(diphenoxy)phosphanium (CID 162036820) is cobalt;oxo(diphenoxy)phosphanium.
What is the SMILES notation for cobalt;oxo(diphenoxy)phosphanium?
The canonical SMILES for cobalt;oxo(diphenoxy)phosphanium is O=[P+](Oc1ccccc1)Oc1ccccc1.[Co].
What is the InChIKey of cobalt;oxo(diphenoxy)phosphanium?
The InChIKey is DGEUYIDQQHDMEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O3P.Co/c13-16(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12;/h1-10H;/q+1;.
What are the key properties of cobalt;oxo(diphenoxy)phosphanium?
cobalt;oxo(diphenoxy)phosphanium has a molecular weight of 292.12 g/mol, XLogP of 3.80, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;oxo(diphenoxy)phosphanium is sourced from PubChem (CID 162036820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).