About diphenyl hydrogen phosphite;oxo(diphenoxy)phosphanium
diphenyl hydrogen phosphite;oxo(diphenoxy)phosphanium (PubChem CID 87382332) has the molecular formula C24H21O6P2+
and a molecular weight of 467.37 g/mol. Its IUPAC name is diphenyl hydrogen phosphite;oxo(diphenoxy)phosphanium.
Molecular Properties
| Compound Name | diphenyl hydrogen phosphite;oxo(diphenoxy)phosphanium |
| PubChem CID | 87382332 |
| Molecular Formula | C24H21O6P2+ |
| Molecular Weight | 467.37 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | diphenyl hydrogen phosphite;oxo(diphenoxy)phosphanium |
| SMILES | O=[P+](Oc1ccccc1)Oc1ccccc1.OP(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C12H11O3P.C12H10O3P/c2*13-16(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1-10,13H;1-10H/q;+1 |
| InChIKey | VOZNOGGKTSXERE-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 467.37 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diphenyl hydrogen phosphite;oxo(diphenoxy)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyl hydrogen phosphite;oxo(diphenoxy)phosphanium?
The IUPAC name of diphenyl hydrogen phosphite;oxo(diphenoxy)phosphanium (CID 87382332) is diphenyl hydrogen phosphite;oxo(diphenoxy)phosphanium.
What is the SMILES notation for diphenyl hydrogen phosphite;oxo(diphenoxy)phosphanium?
The canonical SMILES for diphenyl hydrogen phosphite;oxo(diphenoxy)phosphanium is O=[P+](Oc1ccccc1)Oc1ccccc1.OP(Oc1ccccc1)Oc1ccccc1.
What is the InChIKey of diphenyl hydrogen phosphite;oxo(diphenoxy)phosphanium?
The InChIKey is VOZNOGGKTSXERE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11O3P.C12H10O3P/c2*13-16(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1-10,13H;1-10H/q;+1.
What are the key properties of diphenyl hydrogen phosphite;oxo(diphenoxy)phosphanium?
diphenyl hydrogen phosphite;oxo(diphenoxy)phosphanium has a molecular weight of 467.37 g/mol, XLogP of 7.17, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyl hydrogen phosphite;oxo(diphenoxy)phosphanium is sourced from PubChem (CID 87382332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).