diphenyl hydrogen phosphite;oxo(diphenoxy)phosphanium

C24H21O6P2+ — CID 87382332

IUPACdiphenyl hydrogen phosphite;oxo(diphenoxy)phosphanium
SMILESO=[P+](Oc1ccccc1)Oc1ccccc1.OP(Oc1ccccc1)Oc1ccccc1
InChIInChI=1S/C12H11O3P.C12H10O3P/c2*13-16(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1-10,13H;1-10H/q;+1
InChIKeyVOZNOGGKTSXERE-UHFFFAOYSA-N
MW467.37 g/mol
LogP7.17
Rot. Bonds8

About diphenyl hydrogen phosphite;oxo(diphenoxy)phosphanium

diphenyl hydrogen phosphite;oxo(diphenoxy)phosphanium (PubChem CID 87382332) has the molecular formula C24H21O6P2+ and a molecular weight of 467.37 g/mol. Its IUPAC name is diphenyl hydrogen phosphite;oxo(diphenoxy)phosphanium.

Molecular Properties

Compound Namediphenyl hydrogen phosphite;oxo(diphenoxy)phosphanium
PubChem CID87382332
Molecular FormulaC24H21O6P2+
Molecular Weight467.37 g/mol
Exact Mass467.08
IUPAC Namediphenyl hydrogen phosphite;oxo(diphenoxy)phosphanium
SMILESO=[P+](Oc1ccccc1)Oc1ccccc1.OP(Oc1ccccc1)Oc1ccccc1
InChIInChI=1S/C12H11O3P.C12H10O3P/c2*13-16(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1-10,13H;1-10H/q;+1
InChIKeyVOZNOGGKTSXERE-UHFFFAOYSA-N
XLogP7.17
TPSA74.22 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds8
Heavy Atoms32
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500467.37
LogP ≤ 57.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze diphenyl hydrogen phosphite;oxo(diphenoxy)phosphanium with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of diphenyl hydrogen phosphite;oxo(diphenoxy)phosphanium?
The IUPAC name of diphenyl hydrogen phosphite;oxo(diphenoxy)phosphanium (CID 87382332) is diphenyl hydrogen phosphite;oxo(diphenoxy)phosphanium.
What is the SMILES notation for diphenyl hydrogen phosphite;oxo(diphenoxy)phosphanium?
The canonical SMILES for diphenyl hydrogen phosphite;oxo(diphenoxy)phosphanium is O=[P+](Oc1ccccc1)Oc1ccccc1.OP(Oc1ccccc1)Oc1ccccc1.
What is the InChIKey of diphenyl hydrogen phosphite;oxo(diphenoxy)phosphanium?
The InChIKey is VOZNOGGKTSXERE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11O3P.C12H10O3P/c2*13-16(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1-10,13H;1-10H/q;+1.
What are the key properties of diphenyl hydrogen phosphite;oxo(diphenoxy)phosphanium?
diphenyl hydrogen phosphite;oxo(diphenoxy)phosphanium has a molecular weight of 467.37 g/mol, XLogP of 7.17, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyl hydrogen phosphite;oxo(diphenoxy)phosphanium is sourced from PubChem (CID 87382332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).