About magnesium;hydride;oxo-phenoxy-phenylphosphanium
magnesium;hydride;oxo-phenoxy-phenylphosphanium (PubChem CID 173003254) has the molecular formula C12H12MgO2P+
and a molecular weight of 243.51 g/mol. Its IUPAC name is magnesium;hydride;oxo-phenoxy-phenylphosphanium.
Molecular Properties
| Compound Name | magnesium;hydride;oxo-phenoxy-phenylphosphanium |
|---|
| PubChem CID | 173003254 |
|---|
| Molecular Formula | C12H12MgO2P+ |
|---|
| Molecular Weight | 243.51 g/mol |
|---|
| Exact Mass | 243.04 |
|---|
| IUPAC Name | magnesium;hydride;oxo-phenoxy-phenylphosphanium |
|---|
| SMILES | O=[P+](Oc1ccccc1)c1ccccc1.[H-].[H-].[Mg+2] |
|---|
| InChI | InChI=1S/C12H10O2P.Mg.2H/c13-15(12-9-5-2-6-10-12)14-11-7-3-1-4-8-11;;;/h1-10H;;;/q+1;+2;2*-1 |
|---|
| InChIKey | LBFGTLNAZUFDSQ-UHFFFAOYSA-N |
|---|
| XLogP | 2.98 |
|---|
| TPSA | 26.30 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | 2 |
|---|
| Rotatable Bonds | 3 |
|---|
| Heavy Atoms | 16 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 243.51 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze magnesium;hydride;oxo-phenoxy-phenylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;hydride;oxo-phenoxy-phenylphosphanium?
The IUPAC name of magnesium;hydride;oxo-phenoxy-phenylphosphanium (CID 173003254) is magnesium;hydride;oxo-phenoxy-phenylphosphanium.
What is the SMILES notation for magnesium;hydride;oxo-phenoxy-phenylphosphanium?
The canonical SMILES for magnesium;hydride;oxo-phenoxy-phenylphosphanium is O=[P+](Oc1ccccc1)c1ccccc1.[H-].[H-].[Mg+2].
What is the InChIKey of magnesium;hydride;oxo-phenoxy-phenylphosphanium?
The InChIKey is LBFGTLNAZUFDSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O2P.Mg.2H/c13-15(12-9-5-2-6-10-12)14-11-7-3-1-4-8-11;;;/h1-10H;;;/q+1;+2;2*-1.
What are the key properties of magnesium;hydride;oxo-phenoxy-phenylphosphanium?
magnesium;hydride;oxo-phenoxy-phenylphosphanium has a molecular weight of 243.51 g/mol, XLogP of 2.98, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;hydride;oxo-phenoxy-phenylphosphanium is sourced from PubChem (CID 173003254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).