About oxo-phenyl-(trimethyl-λ4-sulfanyl)oxyphosphanium
oxo-phenyl-(trimethyl-λ4-sulfanyl)oxyphosphanium (PubChem CID 57124965) has the molecular formula C9H14O2PS+
and a molecular weight of 217.25 g/mol. Its IUPAC name is oxo-phenyl-(trimethyl-λ4-sulfanyl)oxyphosphanium.
Molecular Properties
| Compound Name | oxo-phenyl-(trimethyl-λ4-sulfanyl)oxyphosphanium |
| PubChem CID | 57124965 |
| Molecular Formula | C9H14O2PS+ |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | oxo-phenyl-(trimethyl-λ4-sulfanyl)oxyphosphanium |
| SMILES | CS(C)(C)O[P+](=O)c1ccccc1 |
| InChI | InChI=1S/C9H14O2PS/c1-13(2,3)11-12(10)9-7-5-4-6-8-9/h4-8H,1-3H3/q+1 |
| InChIKey | XREXRPGIIHBRNS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze oxo-phenyl-(trimethyl-λ4-sulfanyl)oxyphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxo-phenyl-(trimethyl-λ4-sulfanyl)oxyphosphanium?
The IUPAC name of oxo-phenyl-(trimethyl-λ4-sulfanyl)oxyphosphanium (CID 57124965) is oxo-phenyl-(trimethyl-λ4-sulfanyl)oxyphosphanium.
What is the SMILES notation for oxo-phenyl-(trimethyl-λ4-sulfanyl)oxyphosphanium?
The canonical SMILES for oxo-phenyl-(trimethyl-λ4-sulfanyl)oxyphosphanium is CS(C)(C)O[P+](=O)c1ccccc1.
What is the InChIKey of oxo-phenyl-(trimethyl-λ4-sulfanyl)oxyphosphanium?
The InChIKey is XREXRPGIIHBRNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O2PS/c1-13(2,3)11-12(10)9-7-5-4-6-8-9/h4-8H,1-3H3/q+1.
What are the key properties of oxo-phenyl-(trimethyl-λ4-sulfanyl)oxyphosphanium?
oxo-phenyl-(trimethyl-λ4-sulfanyl)oxyphosphanium has a molecular weight of 217.25 g/mol, XLogP of 2.68, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oxo-phenyl-(trimethyl-λ4-sulfanyl)oxyphosphanium is sourced from PubChem (CID 57124965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).