About cerium;ethyl-oxo-phenoxyphosphanium
cerium;ethyl-oxo-phenoxyphosphanium (PubChem CID 174771782) has the molecular formula C8H10CeO2P+
and a molecular weight of 309.26 g/mol. Its IUPAC name is cerium;ethyl-oxo-phenoxyphosphanium.
Molecular Properties
| Compound Name | cerium;ethyl-oxo-phenoxyphosphanium |
| PubChem CID | 174771782 |
| Molecular Formula | C8H10CeO2P+ |
| Molecular Weight | 309.26 g/mol |
| Exact Mass | 308.95 |
| IUPAC Name | cerium;ethyl-oxo-phenoxyphosphanium |
| SMILES | CC[P+](=O)Oc1ccccc1.[Ce] |
| InChI | InChI=1S/C8H10O2P.Ce/c1-2-11(9)10-8-6-4-3-5-7-8;/h3-7H,2H2,1H3;/q+1; |
| InChIKey | YLILXVATZQGPEJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.26 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze cerium;ethyl-oxo-phenoxyphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cerium;ethyl-oxo-phenoxyphosphanium?
The IUPAC name of cerium;ethyl-oxo-phenoxyphosphanium (CID 174771782) is cerium;ethyl-oxo-phenoxyphosphanium.
What is the SMILES notation for cerium;ethyl-oxo-phenoxyphosphanium?
The canonical SMILES for cerium;ethyl-oxo-phenoxyphosphanium is CC[P+](=O)Oc1ccccc1.[Ce].
What is the InChIKey of cerium;ethyl-oxo-phenoxyphosphanium?
The InChIKey is YLILXVATZQGPEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2P.Ce/c1-2-11(9)10-8-6-4-3-5-7-8;/h3-7H,2H2,1H3;/q+1;.
What are the key properties of cerium;ethyl-oxo-phenoxyphosphanium?
cerium;ethyl-oxo-phenoxyphosphanium has a molecular weight of 309.26 g/mol, XLogP of 2.83, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cerium;ethyl-oxo-phenoxyphosphanium is sourced from PubChem (CID 174771782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).