C18H32N2O5P+ — CID 174815200
bis[2-ethyl-2-(prop-2-enoylamino)butoxy]-oxophosphanium (PubChem CID 174815200) has the molecular formula C18H32N2O5P+ and a molecular weight of 387.44 g/mol. Its IUPAC name is bis[2-ethyl-2-(prop-2-enoylamino)butoxy]-oxophosphanium.
| Compound Name | bis[2-ethyl-2-(prop-2-enoylamino)butoxy]-oxophosphanium |
|---|---|
| PubChem CID | 174815200 |
| Molecular Formula | C18H32N2O5P+ |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | bis[2-ethyl-2-(prop-2-enoylamino)butoxy]-oxophosphanium |
| SMILES | C=CC(=O)NC(CC)(CC)CO[P+](=O)OCC(CC)(CC)NC(=O)C=C |
| InChI | InChI=1S/C18H31N2O5P/c1-7-15(21)19-17(9-3,10-4)13-24-26(23)25-14-18(11-5,12-6)20-16(22)8-2/h7-8H,1-2,9-14H2,3-6H3,(H-,19,20,21,22)/p+1 |
| InChIKey | RFUYRQVKETVRLW-UHFFFAOYSA-O |
| XLogP | 3.40 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|