C7H19ClO7P+ — CID 88829680
2,2-bis(hydroxymethyl)propane-1,3-diol;chloroethane;dihydroxy(oxo)phosphanium (PubChem CID 88829680) has the molecular formula C7H19ClO7P+ and a molecular weight of 281.65 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)propane-1,3-diol;chloroethane;dihydroxy(oxo)phosphanium.
| Compound Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;chloroethane;dihydroxy(oxo)phosphanium |
|---|---|
| PubChem CID | 88829680 |
| Molecular Formula | C7H19ClO7P+ |
| Molecular Weight | 281.65 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;chloroethane;dihydroxy(oxo)phosphanium |
| SMILES | CCCl.O=[P+](O)O.OCC(CO)(CO)CO |
| InChI | InChI=1S/C5H12O4.C2H5Cl.HO3P/c6-1-5(2-7,3-8)4-9;1-2-3;1-4(2)3/h6-9H,1-4H2;2H2,1H3;(H-,1,2,3)/p+1 |
| InChIKey | RUSQWJPGWHZZET-UHFFFAOYSA-O |
| XLogP | -1.18 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.65 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|