C6H6Br6O3 — CID 59927307
(1,1,1,3,3,3-hexabromo-2-methylpropan-2-yl) methyl carbonate (PubChem CID 59927307) has the molecular formula C6H6Br6O3 and a molecular weight of 605.53 g/mol. Its IUPAC name is (1,1,1,3,3,3-hexabromo-2-methylpropan-2-yl) methyl carbonate.
| Compound Name | (1,1,1,3,3,3-hexabromo-2-methylpropan-2-yl) methyl carbonate |
|---|---|
| PubChem CID | 59927307 |
| Molecular Formula | C6H6Br6O3 |
| Molecular Weight | 605.53 g/mol |
| Exact Mass | 599.54 |
| IUPAC Name | (1,1,1,3,3,3-hexabromo-2-methylpropan-2-yl) methyl carbonate |
| SMILES | COC(=O)OC(C)(C(Br)(Br)Br)C(Br)(Br)Br |
| InChI | InChI=1S/C6H6Br6O3/c1-4(5(7,8)9,6(10,11)12)15-3(13)14-2/h1-2H3 |
| InChIKey | JKOHUDBWLAFZMU-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.53 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|