About methylsulfanyl N-propylcarbamate
methylsulfanyl N-propylcarbamate (PubChem CID 154454730) has the molecular formula C5H11NO2S
and a molecular weight of 149.22 g/mol. Its IUPAC name is methylsulfanyl N-propylcarbamate.
Molecular Properties
| Compound Name | methylsulfanyl N-propylcarbamate |
| PubChem CID | 154454730 |
| Molecular Formula | C5H11NO2S |
| Molecular Weight | 149.22 g/mol |
| Exact Mass | 149.05 |
| IUPAC Name | methylsulfanyl N-propylcarbamate |
| SMILES | CCCNC(=O)OSC |
| InChI | InChI=1S/C5H11NO2S/c1-3-4-6-5(7)8-9-2/h3-4H2,1-2H3,(H,6,7) |
| InChIKey | SEUZVFHFAOCJOO-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.22 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methylsulfanyl N-propylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylsulfanyl N-propylcarbamate?
The IUPAC name of methylsulfanyl N-propylcarbamate (CID 154454730) is methylsulfanyl N-propylcarbamate.
What is the SMILES notation for methylsulfanyl N-propylcarbamate?
The canonical SMILES for methylsulfanyl N-propylcarbamate is CCCNC(=O)OSC.
What is the InChIKey of methylsulfanyl N-propylcarbamate?
The InChIKey is SEUZVFHFAOCJOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2S/c1-3-4-6-5(7)8-9-2/h3-4H2,1-2H3,(H,6,7).
What are the key properties of methylsulfanyl N-propylcarbamate?
methylsulfanyl N-propylcarbamate has a molecular weight of 149.22 g/mol, XLogP of 1.40, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methylsulfanyl N-propylcarbamate is sourced from PubChem (CID 154454730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).